Benzoic acid,4-chloro-, phenyl ester structure
|
Common Name | Benzoic acid,4-chloro-, phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 1871-38-1 | Molecular Weight | 232.66200 | |
| Density | 1.258g/cm3 | Boiling Point | 356.5ºC at 760mmHg | |
| Molecular Formula | C13H9ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.2ºC | |
| Name | phenyl 4-chlorobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.258g/cm3 |
|---|---|
| Boiling Point | 356.5ºC at 760mmHg |
| Molecular Formula | C13H9ClO2 |
| Molecular Weight | 232.66200 |
| Flash Point | 185.2ºC |
| Exact Mass | 232.02900 |
| PSA | 26.30000 |
| LogP | 3.55920 |
| Vapour Pressure | 2.91E-05mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | XXXJKBSLNRMHLH-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccccc1)c1ccc(Cl)cc1 |
| HS Code | 2916399090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-Chlor-benzoesaeure-phenylester |
| phenyl p-chlorobenzoate |
| 4-chlorobenzoic acid phenyl ester |