2-(4-chlorophenyl)-5,5-dimethyl-1,3-dioxane structure
|
Common Name | 2-(4-chlorophenyl)-5,5-dimethyl-1,3-dioxane | ||
|---|---|---|---|---|
| CAS Number | 6283-10-9 | Molecular Weight | 226.69900 | |
| Density | 1.116g/cm3 | Boiling Point | 299.2ºC at 760 mmHg | |
| Molecular Formula | C12H15ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 102.8ºC | |
| Name | 2-(4-chlorophenyl)-5,5-dimethyl-1,3-dioxane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.116g/cm3 |
|---|---|
| Boiling Point | 299.2ºC at 760 mmHg |
| Molecular Formula | C12H15ClO2 |
| Molecular Weight | 226.69900 |
| Flash Point | 102.8ºC |
| Exact Mass | 226.07600 |
| PSA | 18.46000 |
| LogP | 3.41160 |
| Index of Refraction | 1.505 |
| InChIKey | LYFASGHSQCWAFH-UHFFFAOYSA-N |
| SMILES | CC1(C)COC(c2ccc(Cl)cc2)OC1 |
|
~95%
2-(4-chlorophen... CAS#:6283-10-9 |
| Literature: Bandgar, Babasaheb P.; Gaikwad, Nandkumar B. Monatshefte fur Chemie, 1998 , vol. 129, # 6-7 p. 719 - 722 |
|
~97%
2-(4-chlorophen... CAS#:6283-10-9 |
| Literature: Rahimizadeh, Mohammad; Bakavoli, Mehdi; Shiri, Ali; Eshghi, Hossein; Saberi, Sattar Journal of Chemical Research, 2008 , # 12 p. 704 - 706 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-(4-chloro-phenyl)-5,5-dimethyl-[1,3]dioxane |