ethyl 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-oxo-oxolane-3-carboxylate structure
|
Common Name | ethyl 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-oxo-oxolane-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 6284-28-2 | Molecular Weight | 317.29300 | |
| Density | 1.4g/cm3 | Boiling Point | 503.6ºC at 760 mmHg | |
| Molecular Formula | C16H15NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.4ºC | |
| Name | [[(2R,3S,4R,5S)-5-(2,4-dioxopyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 503.6ºC at 760 mmHg |
| Molecular Formula | C16H15NO6 |
| Molecular Weight | 317.29300 |
| Flash Point | 258.4ºC |
| Exact Mass | 317.09000 |
| PSA | 89.98000 |
| LogP | 0.71530 |
| Index of Refraction | 1.586 |
| InChIKey | NXUPFKOOJSNJCJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC(CN2C(=O)c3ccccc3C2=O)OC1=O |
|
~%
ethyl 5-[(1,3-d... CAS#:6284-28-2 |
| Literature: Dey Journal of the Chemical Society, 1937 , p. 1166 |
| 3-Deazauridine 5'-triphosphate |
| 2-Oxo-5-phthalimidomethyl-tetrahydro-furan-3-carbonsaeure-aethylester |
| 2-oxo-5-phthalimidomethyl-tetrahydro-furan-3-carboxylic acid ethyl ester |
| 3-Deaza-utp |