(3,4-dichlorophenyl)(phenyl)methanone structure
|
Common Name | (3,4-dichlorophenyl)(phenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 6284-79-3 | Molecular Weight | 251.10800 | |
| Density | 1.311 g/cm3 | Boiling Point | 353ºC at 760 mmHg | |
| Molecular Formula | C13H8Cl2O | Melting Point | 100-103 °C | |
| MSDS | USA | Flash Point | 156.2ºC | |
| Name | 3,4-Dichlorobenzophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.311 g/cm3 |
|---|---|
| Boiling Point | 353ºC at 760 mmHg |
| Melting Point | 100-103 °C |
| Molecular Formula | C13H8Cl2O |
| Molecular Weight | 251.10800 |
| Flash Point | 156.2ºC |
| Exact Mass | 249.99500 |
| PSA | 17.07000 |
| LogP | 4.22440 |
| Index of Refraction | 1.603 |
| InChIKey | LLUPHTAYNHAVQT-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1ccc(Cl)c(Cl)c1 |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S37/39-S26-S24/25 |
| HS Code | 2914700090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 3,4-Dichlor-benzophenon |
| EINECS 228-509-5 |
| 3,4-dichloro-benzophenone |
| 3,4-DiChlororobenzo phenone |
| MFCD00000552 |
| 3,4-Dichlorophenyl phenyl ketone |
| Phenyl 3,4-dichlorophenyl ketone |