3-Hydroxy-4-methoxy-2-nitrobenzaldehyde structure
|
Common Name | 3-Hydroxy-4-methoxy-2-nitrobenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 6284-92-0 | Molecular Weight | 197.145 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 343.1±42.0 °C at 760 mmHg | |
| Molecular Formula | C8H7NO5 | Melting Point | 147-148ºC | |
| MSDS | N/A | Flash Point | 161.3±27.9 °C | |
| Name | 3-hydroxy-4-methoxy-2-nitrobenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 343.1±42.0 °C at 760 mmHg |
| Melting Point | 147-148ºC |
| Molecular Formula | C8H7NO5 |
| Molecular Weight | 197.145 |
| Flash Point | 161.3±27.9 °C |
| Exact Mass | 197.032425 |
| PSA | 92.35000 |
| LogP | 2.00 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | SJAKQVOAWQEVJV-UHFFFAOYSA-N |
| SMILES | COc1ccc(C=O)c([N+](=O)[O-])c1O |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2913000090 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 3-Hydroxy-4-methoxy-2-nitrobenzaldehyde |
| 3-Hydroxy-4-methoxy-2-nitro-benzald |
| 3-Hydroxy-4-methoxy-2-nitro-benzald; ehyde |
| 3-Hydroxy-4-methoxy-2-nitro-benzaldehyde |
| 3-Hydroxy-4-methoxy-2-nitro-benzaldehyd |