2-Propanol,1,3-bis[(7-chloro-4-quinolinyl)amino]- structure
|
Common Name | 2-Propanol,1,3-bis[(7-chloro-4-quinolinyl)amino]- | ||
|---|---|---|---|---|
| CAS Number | 6285-24-1 | Molecular Weight | 413.30000 | |
| Density | 1.464g/cm3 | Boiling Point | 701.8ºC at 760mmHg | |
| Molecular Formula | C21H18Cl2N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 378.2ºC | |
| Name | 1,3-bis[(7-chloroquinolin-4-yl)amino]propan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.464g/cm3 |
|---|---|
| Boiling Point | 701.8ºC at 760mmHg |
| Molecular Formula | C21H18Cl2N4O |
| Molecular Weight | 413.30000 |
| Flash Point | 378.2ºC |
| Exact Mass | 412.08600 |
| PSA | 70.07000 |
| LogP | 5.12070 |
| Index of Refraction | 1.771 |
| InChIKey | ALJKMVZFTOFZCQ-UHFFFAOYSA-N |
| SMILES | OC(CNc1ccnc2cc(Cl)ccc12)CNc1ccnc2cc(Cl)ccc12 |
|
~%
2-Propanol,1,3-... CAS#:6285-24-1 |
| Literature: Pearson; Jones; Cope Journal of the American Chemical Society, 1946 , vol. 68, p. 1227 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,3-bis-(7-chloro-[4]quinolylamino)-propan-2-ol |
| 1,3-Bis-(7-chlor-[4]chinolylamino)-propan-2-ol |