2-methyl-4-[(2-methylphenoxy)methyl]-2-pentyl-1,3-dioxolane structure
|
Common Name | 2-methyl-4-[(2-methylphenoxy)methyl]-2-pentyl-1,3-dioxolane | ||
|---|---|---|---|---|
| CAS Number | 6288-82-0 | Molecular Weight | 278.38700 | |
| Density | 0.987g/cm3 | Boiling Point | 362.1ºC at 760 mmHg | |
| Molecular Formula | C17H26O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 122.2ºC | |
| Name | 2-methyl-4-[(2-methylphenoxy)methyl]-2-pentyl-1,3-dioxolane |
|---|
| Density | 0.987g/cm3 |
|---|---|
| Boiling Point | 362.1ºC at 760 mmHg |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.38700 |
| Flash Point | 122.2ºC |
| Exact Mass | 278.18800 |
| PSA | 27.69000 |
| LogP | 4.08570 |
| Index of Refraction | 1.483 |
| InChIKey | ZTZQHPBVESZMQJ-UHFFFAOYSA-N |
| SMILES | CCCCCC1(C)OCC(COc2ccccc2C)O1 |
|
~%
2-methyl-4-[(2-... CAS#:6288-82-0 |
| Literature: Ludwig et al. Journal of the American Chemical Society, 1952 , vol. 74, p. 1935,1936 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |