6-bromo-2-(5-bromo-2-morpholin-4-yldiazenyl-phenyl)quinazolin-4-amine structure
|
Common Name | 6-bromo-2-(5-bromo-2-morpholin-4-yldiazenyl-phenyl)quinazolin-4-amine | ||
|---|---|---|---|---|
| CAS Number | 62888-09-9 | Molecular Weight | 492.16700 | |
| Density | 1.84g/cm3 | Boiling Point | 567.4ºC at 760 mmHg | |
| Molecular Formula | C18H16Br2N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 297ºC | |
| Name | 6-bromo-2-[5-bromo-2-(morpholin-4-yldiazenyl)phenyl]quinazolin-4-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.84g/cm3 |
|---|---|
| Boiling Point | 567.4ºC at 760 mmHg |
| Molecular Formula | C18H16Br2N6O |
| Molecular Weight | 492.16700 |
| Flash Point | 297ºC |
| Exact Mass | 489.97500 |
| PSA | 88.99000 |
| LogP | 5.25400 |
| Index of Refraction | 1.763 |
| InChIKey | IGEDQRVTAUSFBU-UHFFFAOYSA-N |
| SMILES | Nc1nc(-c2cc(Br)ccc2N=NN2CCOCC2)nc2ccc(Br)cc12 |
|
~%
6-bromo-2-(5-br... CAS#:62888-09-9 |
| Literature: Gescher,A. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1977 , p. 107 - 114 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6-bromo-2-(5-bromo-2-morpholin-4-ylazo-phenyl)-quinazolin-4-ylamine |