Naphtho[2,3-d]-1,3-dioxole-6-carboxylic acid,8-hydroxy-5-(3,4,5-trimethoxyphenyl)-, methyl ester structure
|
Common Name | Naphtho[2,3-d]-1,3-dioxole-6-carboxylic acid,8-hydroxy-5-(3,4,5-trimethoxyphenyl)-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 6289-72-1 | Molecular Weight | 412.38900 | |
| Density | 1.337g/cm3 | Boiling Point | 577.2ºC at 760mmHg | |
| Molecular Formula | C22H20O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.5ºC | |
| Name | methyl 8-hydroxy-5-(3,4,5-trimethoxyphenyl)benzo[f][1,3]benzodioxole-6-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.337g/cm3 |
|---|---|
| Boiling Point | 577.2ºC at 760mmHg |
| Molecular Formula | C22H20O8 |
| Molecular Weight | 412.38900 |
| Flash Point | 201.5ºC |
| Exact Mass | 412.11600 |
| PSA | 92.68000 |
| LogP | 3.75350 |
| Index of Refraction | 1.719 |
| InChIKey | JCWRRVYWBMQVMH-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(O)c2cc3c(cc2c1-c1cc(OC)c(OC)c(OC)c1)OCO3 |
|
~%
Naphtho[2,3-d]-... CAS#:6289-72-1 |
| Literature: Reeve; Myers Journal of the American Chemical Society, 1953 , vol. 75, p. 4957 |
|
~%
Naphtho[2,3-d]-... CAS#:6289-72-1 |
| Literature: Reeve; Myers Journal of the American Chemical Society, 1953 , vol. 75, p. 4957 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 8-Hydroxy-5-(3,4,5-trimethoxy-phenyl)-naphtho[2,3-d][1,3]dioxol-6-carbonsaeure-methylester |
| methyl 8-hydroxy-5-(3,4,5-trimethoxyphenyl)naphtho[2,3-d][1,3]dioxole-6-carboxylate |
| 4-Hydroxy-6.7-methylendioxy-1-<3.4.5-trimethoxy-phenyl>-naphthoesaeure-(2)-methylester |
| 8-hydroxy-5-(3,4,5-trimethoxy-phenyl)-naphtho[2,3-d][1,3]dioxole-6-carboxylic acid methyl ester |