(2R)-2-[(4-Ethyl-2,3-dioxopiperazinyl)carbonylamino]-2-(4-hydroxyphenyl)acetic acid structure
|
Common Name | (2R)-2-[(4-Ethyl-2,3-dioxopiperazinyl)carbonylamino]-2-(4-hydroxyphenyl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 62893-24-7 | Molecular Weight | 335.312 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H17N3O6 | Melting Point | 205 °C (dec.)(lit.) | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (R)-(-)-α-[[(4-Ethyl-2,3-dioxo-1-piperazinyl)carbonyl]amino]-4-hydroxybenzeneacetic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Melting Point | 205 °C (dec.)(lit.) |
| Molecular Formula | C15H17N3O6 |
| Molecular Weight | 335.312 |
| Exact Mass | 335.111725 |
| PSA | 127.25000 |
| LogP | 0.80 |
| Index of Refraction | 1.617 |
| InChIKey | IPARGUVYMOMVNU-LLVKDONJSA-N |
| SMILES | CCN1CCN(C(=O)NC(C(=O)O)c2ccc(O)cc2)C(=O)C1=O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Benzeneacetic acid, α-[[(4-ethyl-2,3-dioxo-1-piperazinyl)carbonyl]amino]-4-hydroxy-, (αR)- |
| (2R)-2-[(4-Ethyl-2,3-dioxopiperazinyl)carbonylamino]-2-(4-hydroxyphenyl)acetic acid |
| EINECS 279-328-3 |
| (2R)-{[(4-Ethyl-2,3-dioxo-1-piperazinyl)carbonyl]amino}(4-hydroxyphenyl)acetic acid |
| (2R)-{[(4-Ethyl-2,3-dioxopiperazin-1-yl)carbonyl]amino}(4-hydroxyphenyl)acetic acid |
| MFCD00792472 |