(2,6-dimethylphenyl) N,N-bis(2-chloroethyl)carbamate
(2,6-dimethylphenyl) N,N-bis(2-chloroethyl)carbamate structure
|
Common Name | (2,6-dimethylphenyl) N,N-bis(2-chloroethyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 62899-52-9 | Molecular Weight | 290.18600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2,6-dimethylphenyl) N,N-bis(2-chloroethyl)carbamate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H17Cl2NO2 |
|---|---|
| Molecular Weight | 290.18600 |
| Exact Mass | 289.06400 |
| PSA | 29.54000 |
| LogP | 3.58180 |
| InChIKey | YDCVNTFPDYHUPV-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C)c1OC(=O)N(CCCl)CCCl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
(2,6-dimethylph... CAS#:62899-52-9 |
| Literature: AB Leo Patent: DE2629657 , 1977 ; Chem.Abstr., 1977 , vol. 86, # 189570 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Carbamic acid,bis(2-chloroethyl)-,2,6-dimethylphenyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (2,6-dimethylphenyl) N,N-bis(2-chloroethyl)carbamate? |
| A: Molecular formula of (2,6-dimethylphenyl) N,N-bis(2-chloroethyl)carbamate is C13H17Cl2NO2. |
| Q: What is the CAS number of (2,6-dimethylphenyl) N,N-bis(2-chloroethyl)carbamate? |
| A: CAS number of (2,6-dimethylphenyl) N,N-bis(2-chloroethyl)carbamate is 62899-52-9. |
| Q: What English synonyms does (2,6-dimethylphenyl) N,N-bis(2-chloroethyl)carbamate have? |
| A: English synonyms of (2,6-dimethylphenyl) N,N-bis(2-chloroethyl)carbamate: Carbamic acid,bis(2-chloroethyl)-,2,6-dimethylphenyl ester. |
| Q: What is the SMILES notation of (2,6-dimethylphenyl) N,N-bis(2-chloroethyl)carbamate? |
| A: SMILES notation of (2,6-dimethylphenyl) N,N-bis(2-chloroethyl)carbamate is Cc1cccc(C)c1OC(=O)N(CCCl)CCCl. |
| Q: What is the English name of (2,6-dimethylphenyl) N,N-bis(2-chloroethyl)carbamate? |
| A: The English name of (2,6-dimethylphenyl) N,N-bis(2-chloroethyl)carbamate is (2,6-dimethylphenyl) N,N-bis(2-chloroethyl)carbamate. |
| Q: What is the InChIKey of (2,6-dimethylphenyl) N,N-bis(2-chloroethyl)carbamate? |
| A: InChIKey of (2,6-dimethylphenyl) N,N-bis(2-chloroethyl)carbamate is YDCVNTFPDYHUPV-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 62899-52-9? |
| A: Chinese name of 62899-52-9 is 62899-52-9. |
| Q: What is the polar surface area (PSA) of (2,6-dimethylphenyl) N,N-bis(2-chloroethyl)carbamate? |
| A: Polar surface area (PSA) of (2,6-dimethylphenyl) N,N-bis(2-chloroethyl)carbamate is 29.54000. |
| Q: What is the LogP of (2,6-dimethylphenyl) N,N-bis(2-chloroethyl)carbamate? |
| A: LogP of (2,6-dimethylphenyl) N,N-bis(2-chloroethyl)carbamate is 3.58180. |
| Q: What is the molecular weight of (2,6-dimethylphenyl) N,N-bis(2-chloroethyl)carbamate? |
| A: Molecular weight of (2,6-dimethylphenyl) N,N-bis(2-chloroethyl)carbamate is 290.18600. |