Butanedioic acid,1,4-bis(2-ethoxy-1-methyl-2-oxoethyl) ester structure
|
Common Name | Butanedioic acid,1,4-bis(2-ethoxy-1-methyl-2-oxoethyl) ester | ||
|---|---|---|---|---|
| CAS Number | 6291-22-1 | Molecular Weight | 318.32000 | |
| Density | 1.16g/cm3 | Boiling Point | 379.4ºC at 760 mmHg | |
| Molecular Formula | C14H22O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.6ºC | |
| Name | bis(1-ethoxy-1-oxopropan-2-yl) butanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 379.4ºC at 760 mmHg |
| Molecular Formula | C14H22O8 |
| Molecular Weight | 318.32000 |
| Flash Point | 163.6ºC |
| Exact Mass | 318.13100 |
| PSA | 105.20000 |
| LogP | 0.75620 |
| Index of Refraction | 1.451 |
| InChIKey | VCVKXBZJTZVRND-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)OC(=O)CCC(=O)OC(C)C(=O)OCC |
|
~%
Butanedioic aci... CAS#:6291-22-1 |
| Literature: Rehberg; Dixon Journal of the American Chemical Society, 1952 , vol. 74, p. 707 |
|
~%
Butanedioic aci... CAS#:6291-22-1 |
| Literature: Friedel; Wurtz Annales de Chimie (Cachan, France), 1861 , vol. <3>63, p. 114 |
|
~%
Butanedioic aci... CAS#:6291-22-1 |
| Literature: Wislicenus Justus Liebigs Annalen der Chemie, 1865 , vol. 133, p. 262 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,9-Dimethyl-4,7-dioxo-3,8-dioxa-decandisaeure-diaethylester |