ethyl 8-chloro-7-methyl-4-oxo-1H-quinoline-3-carboxylate structure
|
Common Name | ethyl 8-chloro-7-methyl-4-oxo-1H-quinoline-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 6291-29-8 | Molecular Weight | 265.69200 | |
| Density | 1.312g/cm3 | Boiling Point | 397ºC at 760 mmHg | |
| Molecular Formula | C13H12ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.9ºC | |
| Name | ethyl 8-chloro-7-methyl-4-oxo-1H-quinoline-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.312g/cm3 |
|---|---|
| Boiling Point | 397ºC at 760 mmHg |
| Molecular Formula | C13H12ClNO3 |
| Molecular Weight | 265.69200 |
| Flash Point | 193.9ºC |
| Exact Mass | 265.05100 |
| PSA | 59.42000 |
| LogP | 3.07890 |
| Index of Refraction | 1.574 |
| InChIKey | PMLXZOBLQOKISR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c[nH]c2c(Cl)c(C)ccc2c1=O |
|
~%
ethyl 8-chloro-... CAS#:6291-29-8 |
| Literature: Breslow et al. Journal of the American Chemical Society, 1946 , vol. 68, p. 1232,1236 |
| 8-Chlor-4-hydroxy-7-methyl-chinolin-3-carbonsaeure-aethylester |
| 8-chloro-4-hydroxy-7-methyl-quinoline-3-carboxylic acid ethyl ester |
| ethyl 8-chloro-7-methyl-4-oxo-1,4-dihydroquinoline-3-carboxylate |