Acetic acid, 2-chloro-,4-(1,1-dimethylethyl)phenyl ester structure
|
Common Name | Acetic acid, 2-chloro-,4-(1,1-dimethylethyl)phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 6291-99-2 | Molecular Weight | 226.69900 | |
| Density | 1.105g/cm3 | Boiling Point | 290.3ºC at 760mmHg | |
| Molecular Formula | C12H15ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.7ºC | |
| Name | (4-tert-butylphenyl) 2-chloroacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.105g/cm3 |
|---|---|
| Boiling Point | 290.3ºC at 760mmHg |
| Molecular Formula | C12H15ClO2 |
| Molecular Weight | 226.69900 |
| Flash Point | 134.7ºC |
| Exact Mass | 226.07600 |
| PSA | 26.30000 |
| LogP | 3.12830 |
| Index of Refraction | 1.504 |
| InChIKey | PYLFASLKMVYXQY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(OC(=O)CCl)cc1 |
|
~%
Acetic acid, 2-... CAS#:6291-99-2 |
| Literature: Tiwari; Singh Journal of the Indian Chemical Society, 1959 , vol. 36, p. 801 |
|
~%
Acetic acid, 2-... CAS#:6291-99-2 |
| Literature: Kamennov,N.A. et al. J. Appl. Chem. USSR (Engl. Transl.), 1967 , vol. 40, # 3 p. 643 - 647,624 - 627 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| (4-tert-butylphenyl)2-chloroacetate |
| 4-tert-butylphenyl chloroacetate |
| (p-tert-Butyl-phenyl)-monochloracetat |
| p-t-Butylphenylchloracetat |
| Chlor-essigsaeure-(4-tert-butyl-phenylester) |
| chloro-acetic acid-(4-tert-butyl-phenyl ester) |