methyl 4,5-diphenyl-3,4-dihydro-2H-pyrrole-3-carboxylate structure
|
Common Name | methyl 4,5-diphenyl-3,4-dihydro-2H-pyrrole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 62920-83-6 | Molecular Weight | 279.33300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 4,5-diphenyl-3,4-dihydro-2H-pyrrole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H17NO2 |
|---|---|
| Molecular Weight | 279.33300 |
| Exact Mass | 279.12600 |
| PSA | 38.66000 |
| LogP | 2.49790 |
| InChIKey | OCMNRGUEENYBHL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CN=C(c2ccccc2)C1c1ccccc1 |
|
~14%
methyl 4,5-diph... CAS#:62920-83-6 |
| Literature: Tsuge, Otohiko; Kanemasa, Shuji; Yamada, Toshiaki; Matsuda, Koyo Journal of Organic Chemistry, 1987 , vol. 52, # 12 p. 2523 - 2530 |
|
~%
methyl 4,5-diph... CAS#:62920-83-6 |
| Literature: Tsuge, Otohiko; Kanemasa, Shuji; Yamada, Toshiaki; Matsuda, Koyo Journal of Organic Chemistry, 1987 , vol. 52, # 12 p. 2523 - 2530 |
| 2H-Pyrrole-3-carboxylic acid,3,4-dihydro-4,5-diphenyl-,methyl ester |
| 4,5-diphenyl-3,4-dihydro-2H-pyrrole-3-carboxylic acid methyl ester |
| 2,3-Diphenyl-1-pyrrolin-4-carbonsaeuremethylester |