Rifamycin,3-(aminomethyl)- (9CI) structure
|
Common Name | Rifamycin,3-(aminomethyl)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 62921-32-8 | Molecular Weight | 726.81000 | |
| Density | 1.36g/cm3 | Boiling Point | 881.9ºC at 760 mmHg | |
| Molecular Formula | C38H50N2O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 487.1ºC | |
| Name | 3-aminomethyl-rifamycin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 881.9ºC at 760 mmHg |
| Molecular Formula | C38H50N2O12 |
| Molecular Weight | 726.81000 |
| Flash Point | 487.1ºC |
| Exact Mass | 726.33600 |
| PSA | 227.33000 |
| LogP | 5.05110 |
| Index of Refraction | 1.637 |
| InChIKey | ZBJJYWIEVGRTPN-AEZIOYLSSA-N |
| SMILES | COC1C=COC2(C)Oc3c(C)c(O)c4c(O)c(c(CN)c(O)c4c3C2=O)NC(=O)C(C)=CC=CC(C)C(O)C(C)C(O)C(C)C(OC(C)=O)C1C |
|
~%
Rifamycin,3-(am... CAS#:62921-32-8 |
| Literature: McCarthy; Moore; Wysong; Aldrich Journal of Medicinal Chemistry, 1977 , vol. 20, # 10 p. 1272 - 1276 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-Aminomethylrifamycin SV |