Rifamycin,3-[(propylamino)methyl]- (9CI) structure
|
Common Name | Rifamycin,3-[(propylamino)methyl]- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 63624-39-5 | Molecular Weight | 768.89000 | |
| Density | 1.31g/cm3 | Boiling Point | 886ºC at 760 mmHg | |
| Molecular Formula | C41H56N2O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 489.6ºC | |
| Name | 3-Propylaminomethyl rifamycin SV |
|---|
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 886ºC at 760 mmHg |
| Molecular Formula | C41H56N2O12 |
| Molecular Weight | 768.89000 |
| Flash Point | 489.6ºC |
| Exact Mass | 768.38300 |
| PSA | 213.34000 |
| LogP | 5.78260 |
| Index of Refraction | 1.619 |
| InChIKey | BBAQUFDWUQOKBU-BYBMDLCRSA-N |
| SMILES | CCCNCc1c2c(O)c3c(O)c(C)c4c(c3c1O)C(=O)C(C)(OC=CC(OC)C(C)C(OC(C)=O)C(C)C(O)C(C)C(O)C(C)C=CC=C(C)C(=O)N2)O4 |
|
~%
Rifamycin,3-[(p... CAS#:63624-39-5 |
| Literature: McCarthy; Moore; Wysong; Aldrich Journal of Medicinal Chemistry, 1977 , vol. 20, # 10 p. 1272 - 1276 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |