1-chloro-4-(2,2-dichloro-1-(4-chlorophenyl)ethenyl)-3-(methylsulfonyl)benzene structure
|
Common Name | 1-chloro-4-(2,2-dichloro-1-(4-chlorophenyl)ethenyl)-3-(methylsulfonyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 62938-14-1 | Molecular Weight | 396.11600 | |
| Density | 1.474g/cm3 | Boiling Point | 530ºC at 760 mmHg | |
| Molecular Formula | C15H10Cl4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.3ºC | |
| Name | 4-chloro-1-[2,2-dichloro-1-(4-chlorophenyl)ethenyl]-2-methylsulfonylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.474g/cm3 |
|---|---|
| Boiling Point | 530ºC at 760 mmHg |
| Molecular Formula | C15H10Cl4O2S |
| Molecular Weight | 396.11600 |
| Flash Point | 274.3ºC |
| Exact Mass | 393.91600 |
| PSA | 42.52000 |
| LogP | 6.67220 |
| Index of Refraction | 1.608 |
| InChIKey | YQCQEXWXRQQMAR-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1cc(Cl)ccc1C(=C(Cl)Cl)c1ccc(Cl)cc1 |
| HS Code | 2904909090 |
|---|
|
~%
1-chloro-4-(2,2... CAS#:62938-14-1 |
| Literature: Bergman; Wachtmeister Acta Chemica Scandinavica, 1977 , vol. 31, # 1 B p. 90 - 91 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,1-dichloro-2-(4-chloro-2-methylsulfonylphenyl)-2-(4-chlorophenyl)ethylene |
| 3-Meso(2)-dde |
| 2-(2-methylsulfonyl-4-chlorophenyl)-2-(4-chlorophenyl)-1,1-dichloroethene |
| 1-Chloro-4-(2,2-dichloro-1-(4-chlorophenyl)ethenyl)-3-(methylsulfonyl)benzene |
| Meso2-dde |
| 3-Methylsulfonyl-dde |
| 5-chloro-2-[2,2-dichloro-1-(4-chlorophenyl)vinyl]phenyl methyl sulfone |