3-(Trifluoromethyl)benzene-1-carboximidamide hydrochloride structure
|
Common Name | 3-(Trifluoromethyl)benzene-1-carboximidamide hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 62980-03-4 | Molecular Weight | 224.61100 | |
| Density | N/A | Boiling Point | 221.7ºC at 760 mmHg | |
| Molecular Formula | C8H8ClF3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 87.9ºC | |
| Name | 3-(Trifluoromethyl)benzene-1-carboximidamide hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 221.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C8H8ClF3N2 |
| Molecular Weight | 224.61100 |
| Flash Point | 87.9ºC |
| Exact Mass | 224.03300 |
| PSA | 49.87000 |
| LogP | 3.59150 |
| InChIKey | JRWQLKZLTWPEBO-UHFFFAOYSA-N |
| SMILES | Cl.N=C(N)c1cccc(C(F)(F)F)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2925290090 |
|
~%
3-(Trifluoromet... CAS#:62980-03-4 |
| Literature: Journal of Medicinal Chemistry, , vol. 33, # 4 p. 1230 - 1241 |
|
~%
3-(Trifluoromet... CAS#:62980-03-4 |
| Literature: Journal of Medicinal Chemistry, , vol. 33, # 4 p. 1230 - 1241 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 3-(trifluoromethyl)benzenecarboximidamide,hydrochloride |