(2-acetamido-4-acetyloxy-naphthalen-1-yl) acetate structure
|
Common Name | (2-acetamido-4-acetyloxy-naphthalen-1-yl) acetate | ||
|---|---|---|---|---|
| CAS Number | 6300-60-3 | Molecular Weight | 301.29400 | |
| Density | 1.299g/cm3 | Boiling Point | 521.3ºC at 760 mmHg | |
| Molecular Formula | C16H15NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269.1ºC | |
| Name | (3-acetamido-4-acetyloxynaphthalen-1-yl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.299g/cm3 |
|---|---|
| Boiling Point | 521.3ºC at 760 mmHg |
| Molecular Formula | C16H15NO5 |
| Molecular Weight | 301.29400 |
| Flash Point | 269.1ºC |
| Exact Mass | 301.09500 |
| PSA | 81.70000 |
| LogP | 2.72180 |
| Index of Refraction | 1.616 |
| InChIKey | PTXJPKFIQMFSAA-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cc(OC(C)=O)c2ccccc2c1OC(C)=O |
|
~%
(2-acetamido-4-... CAS#:6300-60-3 |
| Literature: Fieser; Hartwell Journal of the American Chemical Society, 1935 , vol. 57, p. 1479,1481 |
|
~%
(2-acetamido-4-... CAS#:6300-60-3 |
| Literature: Fieser; Hartwell Journal of the American Chemical Society, 1935 , vol. 57, p. 1479,1481 |
|
~%
(2-acetamido-4-... CAS#:6300-60-3 |
| Literature: Kehrmann Chemische Berichte, 1894 , vol. 27, p. 3343 Justus Liebigs Annalen der Chemie, 1896 , vol. 290, p. 295 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,4-diacetoxy-2-acetylamino-naphthalene |
| 2-Acetamino-1.4-diacetoxy-naphthalin |
| 1,4-Diacetoxy-2-acetylamino-naphthalin |