4,7-Dichloro-3-quinolinecarboxylic acid structure
|
Common Name | 4,7-Dichloro-3-quinolinecarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 630067-21-9 | Molecular Weight | 242.058 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 384.9±37.0 °C at 760 mmHg | |
| Molecular Formula | C10H5Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.6±26.5 °C | |
| Name | 4,7-dichloroquinoline-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 384.9±37.0 °C at 760 mmHg |
| Molecular Formula | C10H5Cl2NO2 |
| Molecular Weight | 242.058 |
| Flash Point | 186.6±26.5 °C |
| Exact Mass | 240.969727 |
| PSA | 50.19000 |
| LogP | 3.10 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.695 |
| InChIKey | MLBIOMJMHCNLEL-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cnc2cc(Cl)ccc2c1Cl |
| HS Code | 2933499090 |
|---|
|
~%
4,7-Dichloro-3-... CAS#:630067-21-9 |
| Literature: AMGEN INC.; FISHER, Benjamin; JOHNSON, Michael G.; LUCAS, Brian; SHIN, Youngsook; KAIZERMAN, Amy Patent: WO2012/61696 A1, 2012 ; Location in patent: Page/Page column 58 ; WO 2012/061696 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,7-Dichloroquinoline-3-carboxylic acid |
| 4,7-dichloro-quinoline-3-carboxylic acid |
| 4,7-Dichloro-3-quinolinecarboxylic acid |
| 3-Quinolinecarboxylic acid, 4,7-dichloro- |