Ethyl 4,7-dichloro-3-quinolinecarboxylate structure
|
Common Name | Ethyl 4,7-dichloro-3-quinolinecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 19499-19-5 | Molecular Weight | 270.111 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 360.0±37.0 °C at 760 mmHg | |
| Molecular Formula | C12H9Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.5±26.5 °C | |
| Name | ethyl 4,7-dichloroquinoline-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 360.0±37.0 °C at 760 mmHg |
| Molecular Formula | C12H9Cl2NO2 |
| Molecular Weight | 270.111 |
| Flash Point | 171.5±26.5 °C |
| Exact Mass | 269.001038 |
| PSA | 39.19000 |
| LogP | 3.81 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | KWYQZEQRIMVMTH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnc2cc(Cl)ccc2c1Cl |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,7-dichloro-3-quinolinecarboxylic acid ethyl ester |
| 4,7-Dichlor-chinolin-carbonsaeure-(3)-ethylester |
| 3-Quinolinecarboxylic acid, 4,7-dichloro-, ethyl ester |
| Ethyl 4,7-dichloro-3-quinolinecarboxylate |
| 4,7-dichloroquinoline-3-carboxylic acid ethyl ester |
| ethyl 4,7-dichloro-quinoline-3-carboxylate |