2-diethylaminoethyl 4-(phenylcarbamoylamino)benzoate structure
|
Common Name | 2-diethylaminoethyl 4-(phenylcarbamoylamino)benzoate | ||
|---|---|---|---|---|
| CAS Number | 63014-02-8 | Molecular Weight | 355.43100 | |
| Density | 1.194g/cm3 | Boiling Point | 431.4ºC at 760 mmHg | |
| Molecular Formula | C20H25N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(diethylamino)ethyl 4-(phenylcarbamoylamino)benzoate |
|---|
| Density | 1.194g/cm3 |
|---|---|
| Boiling Point | 431.4ºC at 760 mmHg |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.43100 |
| Exact Mass | 355.19000 |
| PSA | 70.67000 |
| LogP | 3.97520 |
| Index of Refraction | 1.614 |
| InChIKey | QXTBLOXGYKAAAG-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOC(=O)c1ccc(NC(=O)Nc2ccccc2)cc1 |
|
~%
2-diethylaminoe... CAS#:63014-02-8 |
| Literature: Rabjohn; Shahabeddin Journal of the American Chemical Society, 1952 , vol. 74, p. 3696 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|