3,4-Phenanthrenedicarboxylic acid structure
|
Common Name | 3,4-Phenanthrenedicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 63018-89-3 | Molecular Weight | 266.24800 | |
| Density | 1.457g/cm3 | Boiling Point | 532.1ºC at 760 mmHg | |
| Molecular Formula | C16H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 289.7ºC | |
| Name | phenanthrene-3,4-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.457g/cm3 |
|---|---|
| Boiling Point | 532.1ºC at 760 mmHg |
| Molecular Formula | C16H10O4 |
| Molecular Weight | 266.24800 |
| Flash Point | 289.7ºC |
| Exact Mass | 266.05800 |
| PSA | 74.60000 |
| LogP | 3.38940 |
| Index of Refraction | 1.768 |
| InChIKey | IZXDSGJZIWWWKG-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc2ccc3ccccc3c2c1C(=O)O |
|
~74%
3,4-Phenanthren... CAS#:63018-89-3 |
| Literature: Adeney, Michael; Brown, Roger F. C.; Coulston, Karen J.; Eastwood, Frank W.; James, Ian W. Australian Journal of Chemistry, 1991 , vol. 44, # 7 p. 967 - 980 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 3,4-Phenanthrenedicarboxylic acid |
| Phenanthren-3,4-dicarbonsaeure |