3-(4-diethoxyphosphorylcarbonyloxyphenyl)propanoic acid structure
|
Common Name | 3-(4-diethoxyphosphorylcarbonyloxyphenyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 72304-77-9 | Molecular Weight | 330.27000 | |
| Density | 1.283g/cm3 | Boiling Point | 446.4ºC at 760 mmHg | |
| Molecular Formula | C14H19O7P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.8ºC | |
| Name | 3-(4-diethoxyphosphorylcarbonyloxyphenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.283g/cm3 |
|---|---|
| Boiling Point | 446.4ºC at 760 mmHg |
| Molecular Formula | C14H19O7P |
| Molecular Weight | 330.27000 |
| Flash Point | 223.8ºC |
| Exact Mass | 330.08700 |
| PSA | 108.94000 |
| LogP | 3.46870 |
| Index of Refraction | 1.514 |
| InChIKey | WJLKJPJNDKUQTC-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)C(=O)Oc1ccc(CCC(=O)O)cc1 |
|
~88%
3-(4-diethoxyph... CAS#:72304-77-9 |
| Literature: Astra Lakemedel Aktiebolag Patent: US4372894 A1, 1983 ; US 4372894 A |
|
~%
3-(4-diethoxyph... CAS#:72304-77-9 |
| Literature: Noren; Helgstrand; Johansson; Misiorny; Stening Journal of Medicinal Chemistry, 1983 , vol. 26, # 2 p. 264 - 270 |
|
~86%
3-(4-diethoxyph... CAS#:72304-77-9 |
| Literature: Noren; Helgstrand; Johansson; Misiorny; Stening Journal of Medicinal Chemistry, 1983 , vol. 26, # 2 p. 264 - 270 |
| Diethyl 4-(ethoxycarbonyl)phenoxycarbonylphosphonate |
| Benzenepropanoic acid,4-(((diethoxyphosphinyl)carbonyl)oxy) |
| diethyl p-(ethoxycarbonyl)phenoxycarbonylphosphonate |