Benzamide,3,4-dimethoxy-N-(2-methylpropyl)- structure
|
Common Name | Benzamide,3,4-dimethoxy-N-(2-methylpropyl)- | ||
|---|---|---|---|---|
| CAS Number | 6302-41-6 | Molecular Weight | 237.29500 | |
| Density | 1.042g/cm3 | Boiling Point | 344.9ºC at 760 mmHg | |
| Molecular Formula | C13H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.4ºC | |
| Name | 3,4-dimethoxy-N-(2-methylpropyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.042g/cm3 |
|---|---|
| Boiling Point | 344.9ºC at 760 mmHg |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.29500 |
| Flash Point | 162.4ºC |
| Exact Mass | 237.13600 |
| PSA | 47.56000 |
| LogP | 2.48050 |
| Index of Refraction | 1.501 |
| InChIKey | VBWABQJMGFHEJR-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)NCC(C)C)cc1OC |
| HS Code | 2924299090 |
|---|
|
~51%
Benzamide,3,4-d... CAS#:6302-41-6 |
| Literature: Terada; Motomiya; Yoshioka; Narita; Yasui; Takase Chemical and Pharmaceutical Bulletin, 1987 , vol. 35, # 6 p. 2437 - 2442 |
|
~%
Benzamide,3,4-d... CAS#:6302-41-6 |
| Literature: Terada; Motomiya; Yoshioka; Narita; Yasui; Takase Chemical and Pharmaceutical Bulletin, 1987 , vol. 35, # 6 p. 2437 - 2442 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(2-methylpropyl)-3,4-dimethoxybenzamide |
| N-isobutyl-3,4-dimethoxybenzoic acid amide |