Piperazine,1,4-bis(bromoacetyl)- (7CI,9CI) structure
|
Common Name | Piperazine,1,4-bis(bromoacetyl)- (7CI,9CI) | ||
|---|---|---|---|---|
| CAS Number | 6302-66-5 | Molecular Weight | 328.00100 | |
| Density | 1.848g/cm3 | Boiling Point | 451ºC at 760 mmHg | |
| Molecular Formula | C8H12Br2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.5ºC | |
| Name | 2-bromo-1-[4-(2-bromoacetyl)piperazin-1-yl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.848g/cm3 |
|---|---|
| Boiling Point | 451ºC at 760 mmHg |
| Molecular Formula | C8H12Br2N2O2 |
| Molecular Weight | 328.00100 |
| Flash Point | 226.5ºC |
| Exact Mass | 325.92700 |
| PSA | 40.62000 |
| LogP | 0.32280 |
| Index of Refraction | 1.584 |
| InChIKey | DHZOUIWDQCNEFL-UHFFFAOYSA-N |
| SMILES | O=C(CBr)N1CCN(C(=O)CBr)CC1 |
|
~%
Piperazine,1,4-... CAS#:6302-66-5 |
| Literature: Burakov; Kanibolotskii; Osichenko; Mikhailov; Savelova; Kosmynin Russian Journal of Organic Chemistry, 2001 , vol. 37, # 9 p. 1210 - 1219 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,4-bis-bromoacetyl-piperazine |