Piperazine, 1,4-bis(2-furanylcarbonyl)- (9CI) structure
|
Common Name | Piperazine, 1,4-bis(2-furanylcarbonyl)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 31350-27-3 | Molecular Weight | 274.27200 | |
| Density | 1.317g/cm3 | Boiling Point | 463.6ºC at 760mmHg | |
| Molecular Formula | C14H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.2ºC | |
| Name | [4-(furan-2-carbonyl)piperazin-1-yl]-(furan-2-yl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.317g/cm3 |
|---|---|
| Boiling Point | 463.6ºC at 760mmHg |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.27200 |
| Flash Point | 234.2ºC |
| Exact Mass | 274.09500 |
| PSA | 66.90000 |
| LogP | 1.34660 |
| Index of Refraction | 1.581 |
| InChIKey | UPBRPYUDDNJOLW-UHFFFAOYSA-N |
| SMILES | O=C(c1ccco1)N1CCN(C(=O)c2ccco2)CC1 |
|
~0%
Piperazine, 1,4... CAS#:31350-27-3 |
| Literature: Chou, Wen-Chih; Chou, Ming-Chen; Lu, Yann-Yu; Chen, Shyh-Fong Tetrahedron Letters, 1999 , vol. 40, # 17 p. 3419 - 3422 |
|
~6%
Piperazine, 1,4... CAS#:31350-27-3 |
| Literature: Chou, Wen-Chih; Tan, Chang-Wei; Chen, Shyh-Fong; Ku, Hao Journal of Organic Chemistry, 1998 , vol. 63, # 26 p. 10015 - 10017 |
|
~88%
Piperazine, 1,4... CAS#:31350-27-3 |
| Literature: Drugarin, C.; Jianu, I.; Getia, P.; Drugarin, A. Pharmazie, 1981 , vol. 36, # 10 p. 709 - 710 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| N,N'-bis(furan-2-carbonyl)piperazine |
| [4-(Furan-2-carbonyl)-piperazin-1-yl]-furan-2-yl-methanone |
| 2-furyl 4-(2-furylcarbonyl)piperazinyl ketone |
| 1,4-bis-(furan-2-carbonyl)-piperazine |
| 1,4-bis(2-furanoyl)-piperazine |
| 1,4-di-2-furoylpiperazine |
| piperazine-1,4-diylbis(furan-2-ylmethanone) |
| UNII-CWO0S28C9J |