Benzeneaceticacid, 2-(2-phenylethylidene)hydrazide structure
|
Common Name | Benzeneaceticacid, 2-(2-phenylethylidene)hydrazide | ||
|---|---|---|---|---|
| CAS Number | 6304-42-3 | Molecular Weight | 252.31100 | |
| Density | 1.05g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-phenyl-N-[(Z)-2-phenylethylideneamino]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.05g/cm3 |
|---|---|
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.31100 |
| Exact Mass | 252.12600 |
| PSA | 41.46000 |
| LogP | 2.96470 |
| Index of Refraction | 1.565 |
| InChIKey | JGSJBENEJRWPTO-SFQUDFHCSA-N |
| SMILES | O=C(Cc1ccccc1)NN=CCc1ccccc1 |
|
~%
Benzeneaceticac... CAS#:6304-42-3 |
| Literature: Duschek,C. et al. Journal fuer Praktische Chemie (Leipzig), 1971 , vol. 313, p. 949 - 955 |
|
~%
Benzeneaceticac... CAS#:6304-42-3 |
| Literature: Hunter, Daniel; Neilson, Douglas G. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1985 , p. 1081 - 1086 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Phenylacetaldehyd-phenyl-acetylhydrazon |