6,4'-DIHYDROXYFLAVONE structure
|
Common Name | 6,4'-DIHYDROXYFLAVONE | ||
|---|---|---|---|---|
| CAS Number | 63046-09-3 | Molecular Weight | 254.23700 | |
| Density | 1.443g/cm3 | Boiling Point | 512.8ºC at 760 mmHg | |
| Molecular Formula | C15H10O4 | Melting Point | 340ºC (dec.) | |
| MSDS | N/A | Flash Point | 201.2ºC | |
| Name | 4',6-dihydroxyflavone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.443g/cm3 |
|---|---|
| Boiling Point | 512.8ºC at 760 mmHg |
| Melting Point | 340ºC (dec.) |
| Molecular Formula | C15H10O4 |
| Molecular Weight | 254.23700 |
| Flash Point | 201.2ºC |
| Exact Mass | 254.05800 |
| PSA | 70.67000 |
| LogP | 2.87120 |
| Index of Refraction | 1.698 |
| InChIKey | FFULTBKXWHYHFQ-UHFFFAOYSA-N |
| SMILES | O=c1cc(-c2ccc(O)cc2)oc2ccc(O)cc12 |
| HS Code | 2914501900 |
|---|
|
~%
6,4'-DIHYDROXYF... CAS#:63046-09-3 |
| Literature: Nagarathnam, Dhanapalan; Cushman, Mark Journal of Organic Chemistry, 1991 , vol. 56, # 16 p. 4884 - 4887 |
|
~%
6,4'-DIHYDROXYF... CAS#:63046-09-3 |
| Literature: Nagarathnam, Dhanapalan; Cushman, Mark Journal of Organic Chemistry, 1991 , vol. 56, # 16 p. 4884 - 4887 |
|
~%
6,4'-DIHYDROXYF... CAS#:63046-09-3 |
| Literature: Vyas; Shah Proceedings - Indian Academy of Sciences, Section A, 1951 , # 33 p. 112,113 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914501900 |
|---|---|
| Summary | 2914501900 other ketone-phenols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 6-hydroxy-2-(4-hydroxy-phenyl)-chromen-4-one |
| 6-hydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one |
| 6-Hydroxy-2-(4-hydroxy-phenyl)-chromen-4-on |
| 6-hydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| 6-Hydroxy-4'-hydroxyflavon |
| 6,4'-dihydroxyplavone |
| 6,4'-Dihydroxyflavone |