(E)-2-(1H-benzimidazol-2-yl)-3-(2-chlorophenyl)prop-2-enenitrile structure
|
Common Name | (E)-2-(1H-benzimidazol-2-yl)-3-(2-chlorophenyl)prop-2-enenitrile | ||
|---|---|---|---|---|
| CAS Number | 63052-08-4 | Molecular Weight | 279.72400 | |
| Density | 1.374g/cm3 | Boiling Point | 505.8ºC at 760 mmHg | |
| Molecular Formula | C16H10ClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.7ºC | |
| Name | (E)-2-(1H-benzimidazol-2-yl)-3-(2-chlorophenyl)prop-2-enenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.374g/cm3 |
|---|---|
| Boiling Point | 505.8ºC at 760 mmHg |
| Molecular Formula | C16H10ClN3 |
| Molecular Weight | 279.72400 |
| Flash Point | 259.7ºC |
| Exact Mass | 279.05600 |
| PSA | 52.47000 |
| LogP | 4.28048 |
| Index of Refraction | 1.74 |
| InChIKey | BPSIMQTUJJIVOO-FMIVXFBMSA-N |
| SMILES | N#CC(=Cc1ccccc1Cl)c1nc2ccccc2[nH]1 |
|
~92%
(E)-2-(1H-benzi... CAS#:63052-08-4 |
| Literature: Liu, Shuo; Ni, Yuxiang; Yang, Jianguo; Hu, Huanan; Ying, Anguo; Xu, Songlin Chinese Journal of Chemistry, 2014 , vol. 32, # 4 p. 343 - 348 |
| HMS557F14 |
| 2-(1H-benzoimidazol-2-yl)-3-(2-chloro-phenyl)-acrylonitrile |