5-chloro-4-hydroxy-3-methoxy-2-nitrobenzaldehyde structure
|
Common Name | 5-chloro-4-hydroxy-3-methoxy-2-nitrobenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 63055-06-1 | Molecular Weight | 231.59000 | |
| Density | 1.571g/cm3 | Boiling Point | 382.7ºC at 760 mmHg | |
| Molecular Formula | C8H6ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.3ºC | |
| Name | 5-chloro-4-hydroxy-3-methoxy-2-nitrobenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.571g/cm3 |
|---|---|
| Boiling Point | 382.7ºC at 760 mmHg |
| Molecular Formula | C8H6ClNO5 |
| Molecular Weight | 231.59000 |
| Flash Point | 185.3ºC |
| Exact Mass | 230.99300 |
| PSA | 92.35000 |
| LogP | 2.29810 |
| Index of Refraction | 1.638 |
| InChIKey | DMAJHEIMECUVEK-UHFFFAOYSA-N |
| SMILES | COc1c(O)c(Cl)cc(C=O)c1[N+](=O)[O-] |
|
~%
5-chloro-4-hydr... CAS#:63055-06-1 |
| Literature: Raiford; Lichty Journal of the American Chemical Society, 1930 , vol. 52, p. 4576,4582 |
|
~%
5-chloro-4-hydr... CAS#:63055-06-1 |
| Literature: Raiford; Lichty Journal of the American Chemical Society, 1930 , vol. 52, p. 4576,4582 |
|
~%
5-chloro-4-hydr... CAS#:63055-06-1 |
| Literature: Raiford; Lichty Journal of the American Chemical Society, 1930 , vol. 52, p. 4576,4582 |
|
~%
5-chloro-4-hydr... CAS#:63055-06-1 |
| Literature: Raiford; Lichty Journal of the American Chemical Society, 1930 , vol. 52, p. 4576,4582 |
| 5-chloro-4-hydroxy-2-nitro-3-anisaldehyde |
| 5-Chlor-2-nitro-vanillin |
| benzaldehyde,5-chloro-4-hydroxy-3-methoxy-2-nitro |
| 5-Chlor-4-hydroxy-3-methoxy-2-nitro-benzaldehyd |
| 5-chloro-4-hydroxy-3-methoxy-2-nitro-benzaldehyde |
| 2-Chloro-4-formyl-5-nitro-6-methoxyphenol |