8-(4-hydroxybenzoyl)naphthalene-1-carboxylic acid structure
|
Common Name | 8-(4-hydroxybenzoyl)naphthalene-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 6306-94-1 | Molecular Weight | 292.28500 | |
| Density | 1.374g/cm3 | Boiling Point | 579.4ºC at 760 mmHg | |
| Molecular Formula | C18H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 318.2ºC | |
| Name | 8-(4-hydroxybenzoyl)naphthalene-1-carboxylic acid |
|---|
| Density | 1.374g/cm3 |
|---|---|
| Boiling Point | 579.4ºC at 760 mmHg |
| Molecular Formula | C18H12O4 |
| Molecular Weight | 292.28500 |
| Flash Point | 318.2ºC |
| Exact Mass | 292.07400 |
| PSA | 74.60000 |
| LogP | 3.47460 |
| Index of Refraction | 1.705 |
| InChIKey | YDZMVNJQAIWMKD-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc2cccc(C(=O)c3ccc(O)cc3)c12 |
|
~%
8-(4-hydroxyben... CAS#:6306-94-1 |
| Literature: Blicke; Patelski Journal of the American Chemical Society, 1938 , vol. 60, p. 2283 |
|
~%
8-(4-hydroxyben... CAS#:6306-94-1 |
| Literature: Blicke; Patelski Journal of the American Chemical Society, 1938 , vol. 60, p. 2283 |