2-[(2-nitrophenyl)carbamoyl]benzoic acid
Modify Date: 2025-09-14 00:17:46
![2-[(2-nitrophenyl)carbamoyl]benzoic acid Structure](https://image.chemsrc.com/caspic/411/6307-12-6.png)
2-[(2-nitrophenyl)carbamoyl]benzoic acid structure
|
Common Name | 2-[(2-nitrophenyl)carbamoyl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 6307-12-6 | Molecular Weight | 286.24000 | |
| Density | 1.485g/cm3 | Boiling Point | 425.5ºC at 760 mmHg | |
| Molecular Formula | C14H10N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.1ºC | |
| Name | 2-[(2-nitrophenyl)carbamoyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.485g/cm3 |
|---|---|
| Boiling Point | 425.5ºC at 760 mmHg |
| Molecular Formula | C14H10N2O5 |
| Molecular Weight | 286.24000 |
| Flash Point | 211.1ºC |
| Exact Mass | 286.05900 |
| PSA | 112.22000 |
| LogP | 3.14150 |
| Index of Refraction | 1.697 |
| InChIKey | ZBUFPOWZVYVWNV-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1C(=O)Nc1ccccc1[N+](=O)[O-] |
| HS Code | 2924299090 |
|---|
|
~83%
2-[(2-nitrophen... CAS#:6307-12-6 |
| Literature: Omuaru, Victor O. T.; Boisa, N.; Obuzor, G. U. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1998 , vol. 37, # 7 p. 704 - 706 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-<2-Nitro-phenyl>-phthalaminsaeure |
| o-Nitro-phthalanilinsaeure |
| 2-(2-nitrophenylaminocarbonyl)benzoic acid |
| Phthalanilic acid,2'-nitro |
| Phthalsaeure-mono-(2-nitro-anilid) |
| N-(2-nitro-phenyl)-phthalamic acid |
| N-(2-Nitro-phenyl)-phthalamidsaeure |