2,3,5-triphenylfuran structure
|
Common Name | 2,3,5-triphenylfuran | ||
|---|---|---|---|---|
| CAS Number | 6307-20-6 | Molecular Weight | 296.36200 | |
| Density | 1.105g/cm3 | Boiling Point | 404.8ºC at 760 mmHg | |
| Molecular Formula | C22H16O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.6ºC | |
| Name | 2,3,5-triphenylfuran |
|---|---|
| Synonym | More Synonyms |
| Density | 1.105g/cm3 |
|---|---|
| Boiling Point | 404.8ºC at 760 mmHg |
| Molecular Formula | C22H16O |
| Molecular Weight | 296.36200 |
| Flash Point | 199.6ºC |
| Exact Mass | 296.12000 |
| PSA | 13.14000 |
| LogP | 6.28060 |
| Index of Refraction | 1.604 |
| InChIKey | AHZYJPPGJMXOPB-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2cc(-c3ccccc3)c(-c3ccccc3)o2)cc1 |
| Precursor 9 | |
|---|---|
| DownStream 2 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 2,3,5-triphenyl-furan |