Benzenepentanoic acid,4-(3-carboxy-1-oxopropyl)-, 1-ethyl ester structure
|
Common Name | Benzenepentanoic acid,4-(3-carboxy-1-oxopropyl)-, 1-ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 6308-43-6 | Molecular Weight | 306.35400 | |
| Density | 1.145g/cm3 | Boiling Point | 486.9ºC at 760 mmHg | |
| Molecular Formula | C17H22O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.1ºC | |
| Name | 4-[4-(5-ethoxy-5-oxopentyl)phenyl]-4-oxobutanoic acid |
|---|
| Density | 1.145g/cm3 |
|---|---|
| Boiling Point | 486.9ºC at 760 mmHg |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.35400 |
| Flash Point | 174.1ºC |
| Exact Mass | 306.14700 |
| PSA | 80.67000 |
| LogP | 3.01000 |
| Index of Refraction | 1.522 |
| InChIKey | ANWOGFBOBACIPB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCCc1ccc(C(=O)CCC(=O)O)cc1 |
| HS Code | 2918990090 |
|---|
|
~%
Benzenepentanoi... CAS#:6308-43-6 |
| Literature: Cram; Antar Journal of the American Chemical Society, 1958 , vol. 80, p. 3109,3112 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |