4-(2-acetamidopropyl)benzoic acid structure
|
Common Name | 4-(2-acetamidopropyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 6309-84-8 | Molecular Weight | 221.25200 | |
| Density | 1.16g/cm3 | Boiling Point | 468.7ºC at 760 mmHg | |
| Molecular Formula | C12H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.3ºC | |
| Name | 4-(2-acetamidopropyl)benzoic acid |
|---|
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 468.7ºC at 760 mmHg |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.25200 |
| Flash Point | 237.3ºC |
| Exact Mass | 221.10500 |
| PSA | 66.40000 |
| LogP | 1.84280 |
| Index of Refraction | 1.544 |
| InChIKey | UFNZEQYWUUSELY-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(C)Cc1ccc(C(=O)O)cc1 |
|
~%
4-(2-acetamidop... CAS#:6309-84-8 |
| Literature: Blicke; Lilienfeld Journal of the American Chemical Society, 1943 , vol. 65, p. 2377 |
|
~%
4-(2-acetamidop... CAS#:6309-84-8 |
| Literature: Blicke; Lilienfeld Journal of the American Chemical Society, 1943 , vol. 65, p. 2377 |
|
~%
4-(2-acetamidop... CAS#:6309-84-8 |
| Literature: Blicke; Lilienfeld Journal of the American Chemical Society, 1943 , vol. 65, p. 2377 |