Quillaic Acid structure
|
Common Name | Quillaic Acid | ||
|---|---|---|---|---|
| CAS Number | 631-01-6 | Molecular Weight | 486.683 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 613.3±55.0 °C at 760 mmHg | |
| Molecular Formula | C30H46O5 | Melting Point | 294℃ | |
| MSDS | N/A | Flash Point | 338.7±28.0 °C | |
Use of Quillaic AcidQuillaic acid(Quillaja sapogenin) is the major aglycone of the widely studied saponins of the Chilean indigenous tree Quillaja saponaria Mol; can elicit dose-dependent antinociceptive effects in two murine thermal models. |
| Name | quillaic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Quillaic acid(Quillaja sapogenin) is the major aglycone of the widely studied saponins of the Chilean indigenous tree Quillaja saponaria Mol; can elicit dose-dependent antinociceptive effects in two murine thermal models. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 613.3±55.0 °C at 760 mmHg |
| Melting Point | 294℃ |
| Molecular Formula | C30H46O5 |
| Molecular Weight | 486.683 |
| Flash Point | 338.7±28.0 °C |
| Exact Mass | 486.334534 |
| PSA | 94.83000 |
| LogP | 6.08 |
| Vapour Pressure | 0.0±4.0 mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | MQUFAARYGOUYEV-UAWZMHPWSA-N |
| SMILES | CC1(C)CCC2(C(=O)O)C(O)CC3(C)C(=CCC4C5(C)CCC(O)C(C)(C=O)C5CCC43C)C2C1 |
| Quillaja Sapogenin |
| (3β,16α)-3,16-Dihydroxy-23-oxoolean-12-en-28-oic acid |
| EINECS 211-149-8 |
| (4aR,5R,6aR,6aS,6bR,8aR,9S,10S,12aR,14bS)-9-formyl-5,10-dihydroxy-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
| 3b,16a-Dihydroxy-23-oxoolean-12-en-28-oic Acid |
| Olean-12-en-28-oic acid, 3,16-dihydroxy-23-oxo-, (3β,16α)- |
| Quillaic Acid |
| Quillajasaeure |