(4-chlorophenyl)sulfanyl-(2-furyl)methanone structure
|
Common Name | (4-chlorophenyl)sulfanyl-(2-furyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 6310-30-1 | Molecular Weight | 238.69000 | |
| Density | 1.39g/cm3 | Boiling Point | 326.1ºC at 760 mmHg | |
| Molecular Formula | C11H7ClO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151ºC | |
| Name | S-(4-chlorophenyl) furan-2-carbothioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 326.1ºC at 760 mmHg |
| Molecular Formula | C11H7ClO2S |
| Molecular Weight | 238.69000 |
| Flash Point | 151ºC |
| Exact Mass | 237.98600 |
| PSA | 55.51000 |
| LogP | 3.86550 |
| Index of Refraction | 1.637 |
| InChIKey | BOMQECGCHAMJKS-UHFFFAOYSA-N |
| SMILES | O=C(Sc1ccc(Cl)cc1)c1ccco1 |
|
~41%
(4-chlorophenyl... CAS#:6310-30-1 |
| Literature: Huang, Yu-Ting; Lu, Shao-Yi; Yi, Chih-Lun; Lee, Chin-Fa Journal of Organic Chemistry, 2014 , vol. 79, # 10 p. 4561 - 4568 |
|
~%
(4-chlorophenyl... CAS#:6310-30-1 |
| Literature: Sumrell et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 4313 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-furancarbothioic acid,s-(4-chlorophenyl) ester |
| S-p-chlorophenyl thio-2-furoate |
| 4-chlorophenylthio 2-furyl ketone |
| Furan-2-thiocarbonsaeure-S-(4-chlor-phenylester) |
| furan-2-carbothioic acid S-(4-chloro-phenyl ester) |