1,3-Pentanedione,4,4-dimethyl-1-(4-pyridinyl)
Modify Date: 2026-07-15 11:21:58
1,3-Pentanedione,4,4-dimethyl-1-(4-pyridinyl) structure
|
Common Name | 1,3-Pentanedione,4,4-dimethyl-1-(4-pyridinyl) | ||
|---|---|---|---|---|
| CAS Number | 6312-01-2 | Molecular Weight | 205.25300 | |
| Density | 1.058g/cm3 | Boiling Point | 320.3ºC at 760 mmHg | |
| Molecular Formula | C12H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151.9ºC | |
| Name | 4,4-dimethyl-1-pyridin-4-ylpentane-1,3-dione |
|---|
| Density | 1.058g/cm3 |
|---|---|
| Boiling Point | 320.3ºC at 760 mmHg |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.25300 |
| Flash Point | 151.9ºC |
| Exact Mass | 205.11000 |
| PSA | 47.03000 |
| LogP | 2.26960 |
| Index of Refraction | 1.505 |
| InChIKey | UDVGQWHYFLERJZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)CC(=O)c1ccncc1 |
|
~%
1,3-Pentanedion... CAS#:6312-01-2 |
| Literature: Levine; Sneed Journal of the American Chemical Society, 1951 , vol. 73, p. 5614 |
|
~%
1,3-Pentanedion... CAS#:6312-01-2 |
| Literature: Levine; Sneed Journal of the American Chemical Society, 1951 , vol. 73, p. 5614 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1