2-dimethoxyphosphinothioylsulfanyl-N-methyl-N-nitrosoacetamide structure
|
Common Name | 2-dimethoxyphosphinothioylsulfanyl-N-methyl-N-nitrosoacetamide | ||
|---|---|---|---|---|
| CAS Number | 63124-33-4 | Molecular Weight | 258.25600 | |
| Density | 1.45g/cm3 | Boiling Point | 302.1ºC at 760 mmHg | |
| Molecular Formula | C5H11N2O4PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.5ºC | |
| Name | 2-dimethoxyphosphinothioylsulfanyl-N-methyl-N-nitrosoacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 302.1ºC at 760 mmHg |
| Molecular Formula | C5H11N2O4PS2 |
| Molecular Weight | 258.25600 |
| Flash Point | 136.5ºC |
| Exact Mass | 257.99000 |
| PSA | 135.40000 |
| LogP | 2.02730 |
| Index of Refraction | 1.574 |
| InChIKey | PFQITMJPZJIHQY-UHFFFAOYSA-N |
| SMILES | COP(=S)(OC)SCC(=O)N(C)N=O |
|
~%
2-dimethoxyphos... CAS#:63124-33-4 |
| Literature: Gehlert,P. et al. Zeitschrift fuer Chemie (Stuttgart, Germany), 1977 , vol. 17, p. 18 |
| Phosphorodithioic acid,O,O-dimethyl ester,S-ester with 2-mercapto-N-methyl-N-nitrosoacetamide |
| Nitrosodimethoate |
| O,O-Dimethyl-S-(N-methylcarbamoylmethyl)-dithiophosphorsaeureester-N-nitroso-dimethoat |