2-dimethoxyphosphinothioylsulfanyl-N-methyl-N-nitrosoacetamide
2-dimethoxyphosphinothioylsulfanyl-N-methyl-N-nitrosoacetamide structure
|
Common Name | 2-dimethoxyphosphinothioylsulfanyl-N-methyl-N-nitrosoacetamide | ||
|---|---|---|---|---|
| CAS Number | 63124-33-4 | Molecular Weight | 258.25600 | |
| Density | 1.45g/cm3 | Boiling Point | 302.1ºC at 760 mmHg | |
| Molecular Formula | C5H11N2O4PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-dimethoxyphosphinothioylsulfanyl-N-methyl-N-nitrosoacetamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 302.1ºC at 760 mmHg |
| Molecular Formula | C5H11N2O4PS2 |
| Molecular Weight | 258.25600 |
| Flash Point | 136.5ºC |
| Exact Mass | 257.99000 |
| PSA | 135.40000 |
| LogP | 2.02730 |
| Index of Refraction | 1.574 |
| InChIKey | PFQITMJPZJIHQY-UHFFFAOYSA-N |
| SMILES | COP(=S)(OC)SCC(=O)N(C)N=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-dimethoxyphos... CAS#:63124-33-4 |
| Literature: Gehlert,P. et al. Zeitschrift fuer Chemie (Stuttgart, Germany), 1977 , vol. 17, p. 18 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Phosphorodithioic acid,O,O-dimethyl ester,S-ester with 2-mercapto-N-methyl-N-nitrosoacetamide |
| Nitrosodimethoate |
| O,O-Dimethyl-S-(N-methylcarbamoylmethyl)-dithiophosphorsaeureester-N-nitroso-dimethoat |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-dimethoxyphosphinothioylsulfanyl-N-methyl-N-nitrosoacetamide? |
| A: SMILES notation of 2-dimethoxyphosphinothioylsulfanyl-N-methyl-N-nitrosoacetamide is COP(=S)(OC)SCC(=O)N(C)N=O. |
| Q: What is the CAS number of 2-dimethoxyphosphinothioylsulfanyl-N-methyl-N-nitrosoacetamide? |
| A: CAS number of 2-dimethoxyphosphinothioylsulfanyl-N-methyl-N-nitrosoacetamide is 63124-33-4. |
| Q: What is the Chinese name of 63124-33-4? |
| A: Chinese name of 63124-33-4 is 63124-33-4. |
| Q: What is the InChIKey of 2-dimethoxyphosphinothioylsulfanyl-N-methyl-N-nitrosoacetamide? |
| A: InChIKey of 2-dimethoxyphosphinothioylsulfanyl-N-methyl-N-nitrosoacetamide is PFQITMJPZJIHQY-UHFFFAOYSA-N. |
| Q: What is the boiling point of 2-dimethoxyphosphinothioylsulfanyl-N-methyl-N-nitrosoacetamide? |
| A: Boiling point of 2-dimethoxyphosphinothioylsulfanyl-N-methyl-N-nitrosoacetamide is 302.1ºC at 760 mmHg. |
| Q: What is the English name of 2-dimethoxyphosphinothioylsulfanyl-N-methyl-N-nitrosoacetamide? |
| A: The English name of 2-dimethoxyphosphinothioylsulfanyl-N-methyl-N-nitrosoacetamide is 2-dimethoxyphosphinothioylsulfanyl-N-methyl-N-nitrosoacetamide. |
| Q: What is the LogP of 2-dimethoxyphosphinothioylsulfanyl-N-methyl-N-nitrosoacetamide? |
| A: LogP of 2-dimethoxyphosphinothioylsulfanyl-N-methyl-N-nitrosoacetamide is 2.02730. |
| Q: What is the molecular weight of 2-dimethoxyphosphinothioylsulfanyl-N-methyl-N-nitrosoacetamide? |
| A: Molecular weight of 2-dimethoxyphosphinothioylsulfanyl-N-methyl-N-nitrosoacetamide is 258.25600. |
| Q: What English synonyms does 2-dimethoxyphosphinothioylsulfanyl-N-methyl-N-nitrosoacetamide have? |
| A: English synonyms of 2-dimethoxyphosphinothioylsulfanyl-N-methyl-N-nitrosoacetamide: Phosphorodithioic acid,O,O-dimethyl ester,S-ester with 2-mercapto-N-methyl-N-nitrosoacetamide, Nitrosodimethoate, O,O-Dimethyl-S-(N-methylcarbamoylmethyl)-dithiophosphorsaeureester-N-nitroso-dimethoat. |
| Q: What is the polar surface area (PSA) of 2-dimethoxyphosphinothioylsulfanyl-N-methyl-N-nitrosoacetamide? |
| A: Polar surface area (PSA) of 2-dimethoxyphosphinothioylsulfanyl-N-methyl-N-nitrosoacetamide is 135.40000. |