2-Butenoic acid,4-oxo-4-(2,4,6-trimethylphenyl)-, (2E)- structure
|
Common Name | 2-Butenoic acid,4-oxo-4-(2,4,6-trimethylphenyl)-, (2E)- | ||
|---|---|---|---|---|
| CAS Number | 6313-01-5 | Molecular Weight | 218.24800 | |
| Density | 1.142g/cm3 | Boiling Point | 406.9ºC at 760 mmHg | |
| Molecular Formula | C13H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.1ºC | |
| Name | 4-oxo-4-(2,4,6-trimethylphenyl)but-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.142g/cm3 |
|---|---|
| Boiling Point | 406.9ºC at 760 mmHg |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.24800 |
| Flash Point | 214.1ºC |
| Exact Mass | 218.09400 |
| PSA | 54.37000 |
| LogP | 2.43530 |
| Index of Refraction | 1.558 |
| InChIKey | YZAVQWHPGAFDIH-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(C(=O)C=CC(=O)O)c(C)c1 |
| HS Code | 2918300090 |
|---|
|
~%
2-Butenoic acid... CAS#:6313-01-5 |
| Literature: Lutz; Boyer Journal of the American Chemical Society, 1941 , vol. 63, p. 3189,3191 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-oxo-4-(2.4.6-trimethyl-phenyl)-trans-crotonic acid |
| trans-b-(2,4,6-Trimethylbenzoyl)acrylicacid |
| 4-Oxo-4-(2.4.6-trimethyl-phenyl)-trans-crotonsaeure |
| Acrylic acid,3-(2,4,6-trimethylbenzoyl)-,(E)-(8CI) |
| 2-Butenoicacid,4-oxo-4-(2,4,6-trimethylphenyl)-,(E) |
| 2-Butenoic acid,4-oxo-4-(2,4,6-trimethylphenyl)-,(2E) |
| trans-b-Mesitoylacrylicacid |