4-Chloro-2,5,7-trimethylquinoline structure
|
Common Name | 4-Chloro-2,5,7-trimethylquinoline | ||
|---|---|---|---|---|
| CAS Number | 63136-64-1 | Molecular Weight | 205.68300 | |
| Density | 1.158g/cm3 | Boiling Point | 304.7ºC at 760 mmHg | |
| Molecular Formula | C12H12ClN | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 166.7ºC | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | 4-Chloro-2,5,7-trimethylquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.158g/cm3 |
|---|---|
| Boiling Point | 304.7ºC at 760 mmHg |
| Molecular Formula | C12H12ClN |
| Molecular Weight | 205.68300 |
| Flash Point | 166.7ºC |
| Exact Mass | 205.06600 |
| PSA | 12.89000 |
| LogP | 3.81340 |
| Index of Refraction | 1.609 |
| InChIKey | IQBVBMMNGRIPEI-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c2c(Cl)cc(C)nc2c1 |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H413 |
| Precautionary Statements | P301 + P310 |
| RIDADR | UN 2811 6.1 / PGIII |
| HS Code | 2933499090 |
|
~%
4-Chloro-2,5,7-... CAS#:63136-64-1 |
| Literature: Backeberg; Friedmann Journal of the Chemical Society, 1938 , p. 972,976 |
|
~%
4-Chloro-2,5,7-... CAS#:63136-64-1 |
| Literature: Backeberg; Friedmann Journal of the Chemical Society, 1938 , p. 972,976 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Chlor-2,5,7-trimethyl-chinolin |
| Quinoline,4-chloro-2,5,7-trimethyl |
| 4-chloro-2,5,7-trimethyl-quinoline |