1,2-Ethenediol,1,2-diphenyl-, diacetate (9CI) structure
|
Common Name | 1,2-Ethenediol,1,2-diphenyl-, diacetate (9CI) | ||
|---|---|---|---|---|
| CAS Number | 6316-81-0 | Molecular Weight | 296.31700 | |
| Density | 1.174g/cm3 | Boiling Point | 392.7ºC at 760mmHg | |
| Molecular Formula | C18H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.6ºC | |
| Name | (2-acetyloxy-1,2-diphenylethenyl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.174g/cm3 |
|---|---|
| Boiling Point | 392.7ºC at 760mmHg |
| Molecular Formula | C18H16O4 |
| Molecular Weight | 296.31700 |
| Flash Point | 191.6ºC |
| Exact Mass | 296.10500 |
| PSA | 52.60000 |
| LogP | 3.63860 |
| Index of Refraction | 1.571 |
| InChIKey | OLYDJYCNBCBHOZ-ZCXUNETKSA-N |
| SMILES | CC(=O)OC(=C(OC(C)=O)c1ccccc1)c1ccccc1 |
|
~%
1,2-Ethenediol,... CAS#:6316-81-0 |
| Literature: Davies, Alwyn G.; Hawari, Jalal A.-A. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 875 - 882 |
|
~%
1,2-Ethenediol,... CAS#:6316-81-0 |
| Literature: Davies, Alwyn G.; Hawari, Jalal A.-A. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 875 - 882 |
|
~%
1,2-Ethenediol,... CAS#:6316-81-0 |
| Literature: Davies, Alwyn G.; Hawari, Jalal A.-A. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 875 - 882 |
|
~%
1,2-Ethenediol,... CAS#:6316-81-0 |
| Literature: Thiele Justus Liebigs Annalen der Chemie, 1899 , vol. 306, p. 147,157 |
|
~%
1,2-Ethenediol,... CAS#:6316-81-0 |
| Literature: Nef Justus Liebigs Annalen der Chemie, 1899 , vol. 308, p. 325 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 1,2-diphenyl-1,2-diacetoxyethene |
| Ethanone,2,2-bis(methylthio)-1-phenyl |
| oxo-phenyl-acetaldehyde dimethyl dithioacetal |
| 2,2-di(methylthio)-1-phenyl-1-ethanone |
| 2,2-bis-methylsulfanyl-1-phenyl-ethanone |
| 2,2-Bis-methylmercapto-1-phenyl-aethanon |