(2,2-dimethoxy-1,2-diphenyl-ethyl) acetate structure
|
Common Name | (2,2-dimethoxy-1,2-diphenyl-ethyl) acetate | ||
|---|---|---|---|---|
| CAS Number | 6316-83-2 | Molecular Weight | 300.34900 | |
| Density | 1.125g/cm3 | Boiling Point | 398.4ºC at 760 mmHg | |
| Molecular Formula | C18H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.2ºC | |
| Name | (2,2-dimethoxy-1,2-diphenylethyl) acetate |
|---|
| Density | 1.125g/cm3 |
|---|---|
| Boiling Point | 398.4ºC at 760 mmHg |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.34900 |
| Flash Point | 173.2ºC |
| Exact Mass | 300.13600 |
| PSA | 44.76000 |
| LogP | 3.43660 |
| Index of Refraction | 1.539 |
| InChIKey | GZZIXSRJUBTXKJ-UHFFFAOYSA-N |
| SMILES | COC(OC)(c1ccccc1)C(OC(C)=O)c1ccccc1 |
|
~%
(2,2-dimethoxy-... CAS#:6316-83-2 |
| Literature: Stevens; Weiner; Freeman Journal of the American Chemical Society, 1953 , vol. 75, p. 3977 |
|
~%
(2,2-dimethoxy-... CAS#:6316-83-2 |
| Literature: Stevens; Weiner; Freeman Journal of the American Chemical Society, 1953 , vol. 75, p. 3977 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |