desyl chloride structure
|
Common Name | desyl chloride | ||
|---|---|---|---|---|
| CAS Number | 447-31-4 | Molecular Weight | 230.689 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 345.5±22.0 °C at 760 mmHg | |
| Molecular Formula | C14H11ClO | Melting Point | 62-63 °C(lit.) | |
| MSDS | N/A | Flash Point | 190.4±13.5 °C | |
| Name | desyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 345.5±22.0 °C at 760 mmHg |
| Melting Point | 62-63 °C(lit.) |
| Molecular Formula | C14H11ClO |
| Molecular Weight | 230.689 |
| Flash Point | 190.4±13.5 °C |
| Exact Mass | 230.049850 |
| PSA | 17.07000 |
| LogP | 3.30 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | RXDYOLRABMJTEF-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)C(Cl)c1ccccc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xn:Harmful; |
|---|---|
| Risk Phrases | R20/21;R37 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | AM6825000 |
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2914700090 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| MFCD00000858 |
| desyl chloride |
| 2-Chloro-2-phenylacetophenone |
| EINECS 207-181-7 |
| α-Chlorobenzyl phenyl ketone |
| 2-Chloro-1,2-diphenylethanone |
| α-Chlorodeoxybenzoin |