4-Bromo-3-nitrobenzoic acid structure
|
Common Name | 4-Bromo-3-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 6319-40-0 | Molecular Weight | 246.015 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 340.9±32.0 °C at 760 mmHg | |
| Molecular Formula | C7H4BrNO4 | Melting Point | 202-204ºC | |
| MSDS | Chinese USA | Flash Point | 160.0±25.1 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Bromo-3-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 340.9±32.0 °C at 760 mmHg |
| Melting Point | 202-204ºC |
| Molecular Formula | C7H4BrNO4 |
| Molecular Weight | 246.015 |
| Flash Point | 160.0±25.1 °C |
| Exact Mass | 244.932358 |
| PSA | 83.12000 |
| LogP | 2.59 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.650 |
| InChIKey | RVCTZJVBWNFYRU-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(Br)c([N+](=O)[O-])c1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
| RIDADR | NONH for all modes of transport |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| MFCD00272137 |
| 4-bromo-3-nitro-benzoic acid |
| 4-Brom-3-nitro-benzoesaeure |
| WNR BE EVQ |
| 3-nitro-4-bromobenzoic acid |
| Benzoic acid,4-bromo-3-nitro |
| 4-Bromo-3-nitrobenzoic acid |