1,5-Pentanediol,2,2,3,3,4,4-hexafluoro-, 1,5-bis(4-methylbenzenesulfonate) structure
|
Common Name | 1,5-Pentanediol,2,2,3,3,4,4-hexafluoro-, 1,5-bis(4-methylbenzenesulfonate) | ||
|---|---|---|---|---|
| CAS Number | 632-01-9 | Molecular Weight | 520.46300 | |
| Density | 1.46g/cm3 | Boiling Point | 41.8ºC at 760 mmHg | |
| Molecular Formula | C19H18F6O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,3,3,4,4-Hexafluoropentane-1,5-diyl bis(4-methylbenzenesulfonate) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 41.8ºC at 760 mmHg |
| Molecular Formula | C19H18F6O6S2 |
| Molecular Weight | 520.46300 |
| Exact Mass | 520.04500 |
| PSA | 103.50000 |
| LogP | 6.48170 |
| Index of Refraction | 1.263 |
| InChIKey | LWISLGXGKZSROX-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCC(F)(F)C(F)(F)C(F)(F)COS(=O)(=O)c2ccc(C)cc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2905590090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2905590090 |
|---|---|
| Summary | 2905590090 other halogenated, sulphonated, nitrated or nitrosated derivatives of acyclic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2,2,3,3,4,4-hexafluoropentane-1,5-diyl bis(4-methylbenzenesulfonate) |