Quinolinium,1-[2-(4-bromophenyl)-2-oxoethyl]-6-chloro-, bromide (1:1) structure
|
Common Name | Quinolinium,1-[2-(4-bromophenyl)-2-oxoethyl]-6-chloro-, bromide (1:1) | ||
|---|---|---|---|---|
| CAS Number | 6320-82-7 | Molecular Weight | 441.54400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H12Br2ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-bromophenyl)-2-(6-chloroquinolin-1-ium-1-yl)ethanone,bromide |
|---|
| Molecular Formula | C17H12Br2ClNO |
|---|---|
| Molecular Weight | 441.54400 |
| Exact Mass | 438.89700 |
| PSA | 20.95000 |
| LogP | 1.43010 |
| InChIKey | ODSOTJVHFWVOIJ-UHFFFAOYSA-M |
| SMILES | O=C(C[n+]1cccc2cc(Cl)ccc21)c1ccc(Br)cc1.[Br-] |
|
~%
Quinolinium,1-[... CAS#:6320-82-7 |
| Literature: Bahner et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 3499 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |