1-(4-bromophenyl)-2-(1-ethyl-3,4,5,6-tetrahydro-2H-pyridin-1-yl)ethanone structure
|
Common Name | 1-(4-bromophenyl)-2-(1-ethyl-3,4,5,6-tetrahydro-2H-pyridin-1-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 6320-86-1 | Molecular Weight | 391.14100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21Br2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-bromophenyl)-2-(1-ethylpiperidin-1-ium-1-yl)ethanone,bromide |
|---|
| Molecular Formula | C15H21Br2NO |
|---|---|
| Molecular Weight | 391.14100 |
| Exact Mass | 388.99900 |
| PSA | 17.07000 |
| LogP | 0.61520 |
| InChIKey | WIINRJNIBMFAKZ-UHFFFAOYSA-M |
| SMILES | CC[N+]1(CC(=O)c2ccc(Br)cc2)CCCCC1.[Br-] |
|
~%
1-(4-bromopheny... CAS#:6320-86-1 |
| Literature: Bahner et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 4455 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |